C24H23N3O2S — CID 53099544
1-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 53099544) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 53099544 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NCc2ccc3c(c2)N(C(=O)c2ccccc2)CC3)c1 |
| InChI | InChI=1S/C24H23N3O2S/c1-30-21-9-5-8-20(15-21)26-24(29)25-16-17-10-11-18-12-13-27(22(18)14-17)23(28)19-6-3-2-4-7-19/h2-11,14-15H,12-13,16H2,1H3,(H2,25,26,29) |
| InChIKey | KBYDGAONQIQXOZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |