C18H22N2OS — CID 112839944
1-(2,6-diethylphenyl)-3-(3-methylsulfanylphenyl)urea (PubChem CID 112839944) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 112839944 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-(3-methylsulfanylphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C18H22N2OS/c1-4-13-8-6-9-14(5-2)17(13)20-18(21)19-15-10-7-11-16(12-15)22-3/h6-12H,4-5H2,1-3H3,(H2,19,20,21) |
| InChIKey | ZNYPFYWNLNOZDU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |