C13H20N2OS — CID 51928205
1-(3-methylsulfanylphenyl)-3-[(2R)-pentan-2-yl]urea (PubChem CID 51928205) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-(3-methylsulfanylphenyl)-3-[(2R)-pentan-2-yl]urea.
| Compound Name | 1-(3-methylsulfanylphenyl)-3-[(2R)-pentan-2-yl]urea |
|---|---|
| PubChem CID | 51928205 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(3-methylsulfanylphenyl)-3-[(2R)-pentan-2-yl]urea |
| SMILES | CCC[C@@H](C)NC(=O)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C13H20N2OS/c1-4-6-10(2)14-13(16)15-11-7-5-8-12(9-11)17-3/h5,7-10H,4,6H2,1-3H3,(H2,14,15,16)/t10-/m1/s1 |
| InChIKey | USAJVVZQTPVBOB-SNVBAGLBSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |