C18H21N3O3S — CID 46389828
1-(3,4-dimethylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea (PubChem CID 46389828) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 46389828 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(1-methylsulfonyl-2,3-dihydroindol-5-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3c(c2)CCN3S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C18H21N3O3S/c1-12-4-5-15(10-13(12)2)19-18(22)20-16-6-7-17-14(11-16)8-9-21(17)25(3,23)24/h4-7,10-11H,8-9H2,1-3H3,(H2,19,20,22) |
| InChIKey | SVENPLQXCJTAJP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |