C16H20N4O3 — CID 154751837
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide (PubChem CID 154751837) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide |
|---|---|
| PubChem CID | 154751837 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methyl-2,3-dihydroindol-6-yl)acetamide |
| SMILES | CN1CCc2ccc(NC(=O)CN3C(=O)NC(C)(C)C3=O)cc21 |
| InChI | InChI=1S/C16H20N4O3/c1-16(2)14(22)20(15(23)18-16)9-13(21)17-11-5-4-10-6-7-19(3)12(10)8-11/h4-5,8H,6-7,9H2,1-3H3,(H,17,21)(H,18,23) |
| InChIKey | AVAJDQZCIUQELN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|