C20H16N2O2 — CID 163558325
(Z)-3-(9-but-3-en-2-ylcarbazol-3-yl)-2-cyanoprop-2-enoic acid (PubChem CID 163558325) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is (Z)-3-(9-but-3-en-2-ylcarbazol-3-yl)-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-(9-but-3-en-2-ylcarbazol-3-yl)-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 163558325 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (Z)-3-(9-but-3-en-2-ylcarbazol-3-yl)-2-cyanoprop-2-enoic acid |
| SMILES | C=CC(C)n1c2ccccc2c2cc(/C=C(/C#N)C(=O)O)ccc21 |
| InChI | InChI=1S/C20H16N2O2/c1-3-13(2)22-18-7-5-4-6-16(18)17-11-14(8-9-19(17)22)10-15(12-21)20(23)24/h3-11,13H,1H2,2H3,(H,23,24)/b15-10- |
| InChIKey | FPAIFLMPPBTLGH-GDNBJRDFSA-N |
| XLogP | 4.53 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|