C28H24N2O2 — CID 91075714
2-cyano-3-[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid (PubChem CID 91075714) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-cyano-3-[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91075714 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-cyano-3-[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N3CCCc4cc(C=C(C#N)C(=O)O)ccc43)cc21 |
| InChI | InChI=1S/C28H24N2O2/c1-28(2)24-8-4-3-7-22(24)23-11-10-21(16-25(23)28)30-13-5-6-19-14-18(9-12-26(19)30)15-20(17-29)27(31)32/h3-4,7-12,14-16H,5-6,13H2,1-2H3,(H,31,32) |
| InChIKey | PDFKYNPTGGRKBF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|