C41H35N3O2 — CID 123432724
(E)-2-cyano-3-[1-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid (PubChem CID 123432724) has the molecular formula C41H35N3O2 and a molecular weight of 601.75 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[1-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123432724 |
| Molecular Formula | C41H35N3O2 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | (E)-2-cyano-3-[1-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3,4-dihydro-2H-quinolin-6-yl]prop-2-enoic acid |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=Cc3ccc(N4CCCc5cc(/C=C(\C#N)C(=O)O)ccc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H35N3O2/c1-29-5-16-37(17-6-29)44(38-18-7-30(2)8-19-38)39-22-13-32(14-23-39)10-9-31-11-20-36(21-12-31)43-25-3-4-34-26-33(15-24-40(34)43)27-35(28-42)41(45)46/h5-24,26-27H,3-4,25H2,1-2H3,(H,45,46)/b10-9?,35-27+ |
| InChIKey | FJELKWTWJMLWIA-UBGUJARKSA-N |
| XLogP | 10.02 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|