C41H33N3O2 — CID 102108800
(E)-2-cyano-3-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 102108800) has the molecular formula C41H33N3O2 and a molecular weight of 599.73 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102108800 |
| Molecular Formula | C41H33N3O2 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | (E)-2-cyano-3-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(/C=C/c2ccc3c(c2)C2CCCC2N3c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C41H33N3O2/c42-28-32(41(45)46)26-30-17-14-29(15-18-30)16-19-31-20-25-40-38(27-31)37-12-7-13-39(37)44(40)36-23-21-35(22-24-36)43(33-8-3-1-4-9-33)34-10-5-2-6-11-34/h1-6,8-11,14-27,37,39H,7,12-13H2,(H,45,46)/b19-16+,32-26+ |
| InChIKey | ZDQWVQAMSXTYAC-MZHOUQIHSA-N |
| XLogP | 10.11 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|