C42H33N3O5S — CID 76702108
2-[3-(carboxymethyl)-5-[3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetic acid (PubChem CID 76702108) has the molecular formula C42H33N3O5S and a molecular weight of 691.81 g/mol. Its IUPAC name is 2-[3-(carboxymethyl)-5-[3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetic acid.
| Compound Name | 2-[3-(carboxymethyl)-5-[3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetic acid |
|---|---|
| PubChem CID | 76702108 |
| Molecular Formula | C42H33N3O5S |
| Molecular Weight | 691.81 g/mol |
| Exact Mass | 691.21 |
| IUPAC Name | 2-[3-(carboxymethyl)-5-[3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetic acid |
| SMILES | N#CC(C(=O)O)=c1sc(=CC=Cc2ccc3c(c2)C2CCCC2N3c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)c(=O)n1CC(=O)O |
| InChI | InChI=1S/C42H33N3O5S/c43-25-35(42(49)50)41-44(26-39(46)47)40(48)38(51-41)16-7-9-27-19-22-37-34(24-27)32-14-8-15-36(32)45(37)31-20-17-28(18-21-31)23-33(29-10-3-1-4-11-29)30-12-5-2-6-13-30/h1-7,9-13,16-24,32,36H,8,14-15,26H2,(H,46,47)(H,49,50) |
| InChIKey | GIZDQMOQWCUGRL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|