C52H47N — CID 88529604
4-[4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]phenyl]-7-[(1E,3E)-4-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole (PubChem CID 88529604) has the molecular formula C52H47N and a molecular weight of 685.96 g/mol. Its IUPAC name is 4-[4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]phenyl]-7-[(1E,3E)-4-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole.
| Compound Name | 4-[4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]phenyl]-7-[(1E,3E)-4-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole |
|---|---|
| PubChem CID | 88529604 |
| Molecular Formula | C52H47N |
| Molecular Weight | 685.96 g/mol |
| Exact Mass | 685.37 |
| IUPAC Name | 4-[4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]phenyl]-7-[(1E,3E)-4-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole |
| SMILES | Cc1ccc(C(=C/C=C/c2ccc(N3c4ccc(/C=C/C=C(\c5ccccc5)c5ccc(C)cc5)cc4C4CCCC43)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C52H47N/c1-37-18-27-43(28-19-37)47(42-12-5-4-6-13-42)15-8-11-41-26-35-52-50(36-41)49-16-9-17-51(49)53(52)46-33-24-40(25-34-46)10-7-14-48(44-29-20-38(2)21-30-44)45-31-22-39(3)23-32-45/h4-8,10-15,18-36,49,51H,9,16-17H2,1-3H3/b10-7+,11-8+,47-15+ |
| InChIKey | MOGQWBQIMXWMAH-JUPYDREFSA-N |
| XLogP | 13.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.96 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|