C31H27N2O3 — CID 58321541
CID 58321541 (PubChem CID 58321541) has the molecular formula C31H27N2O3 and a molecular weight of 475.57 g/mol.
| Compound Name | CID 58321541 |
|---|---|
| PubChem CID | 58321541 |
| Molecular Formula | C31H27N2O3 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | — |
| SMILES | C[CH]Oc1ccc(C=Cc2ccc(N3c4ccc(/C=C(\C#N)C(=O)O)cc4C4CCCC43)cc2)cc1 |
| InChI | InChI=1S/C31H27N2O3/c1-2-36-26-15-10-22(11-16-26)7-6-21-8-13-25(14-9-21)33-29-5-3-4-27(29)28-19-23(12-17-30(28)33)18-24(20-32)31(34)35/h2,6-19,27,29H,3-5H2,1H3,(H,34,35)/b7-6?,24-18+ |
| InChIKey | FXNXIFTUVQSZBV-UTANAXIGSA-N |
| XLogP | 7.20 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|