C45H52N4O4 — CID 148968624
(E)-3-[4-[4-[1,1-bis[4-[tert-butyl(methoxy)amino]phenyl]ethyl]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2-cyanoprop-2-enoic acid (PubChem CID 148968624) has the molecular formula C45H52N4O4 and a molecular weight of 712.93 g/mol. Its IUPAC name is (E)-3-[4-[4-[1,1-bis[4-[tert-butyl(methoxy)amino]phenyl]ethyl]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[1,1-bis[4-[tert-butyl(methoxy)amino]phenyl]ethyl]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 148968624 |
| Molecular Formula | C45H52N4O4 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.40 |
| IUPAC Name | (E)-3-[4-[4-[1,1-bis[4-[tert-butyl(methoxy)amino]phenyl]ethyl]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CON(c1ccc(C(C)(c2ccc(N3c4ccc(/C=C(\C#N)C(=O)O)cc4C4CCCC43)cc2)c2ccc(N(OC)C(C)(C)C)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C45H52N4O4/c1-43(2,3)48(52-8)36-22-16-33(17-23-36)45(7,34-18-24-37(25-19-34)49(53-9)44(4,5)6)32-14-20-35(21-15-32)47-40-12-10-11-38(40)39-28-30(13-26-41(39)47)27-31(29-46)42(50)51/h13-28,38,40H,10-12H2,1-9H3,(H,50,51)/b31-27+ |
| InChIKey | PTKRHPHBEOSYHN-TVKQRKNISA-N |
| XLogP | 10.15 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|