C43H46N2O5S — CID 144780217
3-[(E)-2-cyano-3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enoyl]oxypropane-1-sulfonic acid;ethane;prop-1-ene (PubChem CID 144780217) has the molecular formula C43H46N2O5S and a molecular weight of 702.92 g/mol. Its IUPAC name is 3-[(E)-2-cyano-3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enoyl]oxypropane-1-sulfonic acid;ethane;prop-1-ene.
| Compound Name | 3-[(E)-2-cyano-3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enoyl]oxypropane-1-sulfonic acid;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144780217 |
| Molecular Formula | C43H46N2O5S |
| Molecular Weight | 702.92 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | 3-[(E)-2-cyano-3-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]prop-2-enoyl]oxypropane-1-sulfonic acid;ethane;prop-1-ene |
| SMILES | C=CC.CC.N#C/C(=C\c1ccc2c(c1)C1CCCC1N2c1ccc(C=C(c2ccccc2)c2ccccc2)cc1)C(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C38H34N2O5S.C3H6.C2H6/c39-26-31(38(41)45-21-8-22-46(42,43)44)23-28-17-20-37-35(25-28)33-13-7-14-36(33)40(37)32-18-15-27(16-19-32)24-34(29-9-3-1-4-10-29)30-11-5-2-6-12-30;1-3-2;1-2/h1-6,9-12,15-20,23-25,33,36H,7-8,13-14,21-22H2,(H,42,43,44);3H,1H2,2H3;1-2H3/b31-23+;; |
| InChIKey | WHEPMNKOQONYDB-UFKJEFFTSA-N |
| XLogP | 10.01 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.92 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|