C43H37NO4S — CID 144980460
(2E)-2-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,1-dimethyl-1,3-dioxo-1-benzothiophene-5-carboxylic acid (PubChem CID 144980460) has the molecular formula C43H37NO4S and a molecular weight of 663.84 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,1-dimethyl-1,3-dioxo-1-benzothiophene-5-carboxylic acid.
| Compound Name | (2E)-2-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,1-dimethyl-1,3-dioxo-1-benzothiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 144980460 |
| Molecular Formula | C43H37NO4S |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | (2E)-2-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,1-dimethyl-1,3-dioxo-1-benzothiophene-5-carboxylic acid |
| SMILES | CS1(C)(=O)/C(=C/c2ccc3c(c2)C2CCCC2N3c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)C(=O)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C43H37NO4S/c1-49(2,48)40-23-19-32(43(46)47)27-37(40)42(45)41(49)26-29-18-22-39-36(25-29)34-14-9-15-38(34)44(39)33-20-16-28(17-21-33)24-35(30-10-5-3-6-11-30)31-12-7-4-8-13-31/h3-8,10-13,16-27,34,38H,9,14-15H2,1-2H3,(H,46,47)/b41-26+ |
| InChIKey | JUJBVQNMJIQWSJ-MMFILIDRSA-N |
| XLogP | 9.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|