C46H31NO4 — CID 135219308
(2E)-2-[[4-[4-(fluoren-9-ylidenemethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-dioxocyclopenta[a]naphthalene-7-carboxylic acid (PubChem CID 135219308) has the molecular formula C46H31NO4 and a molecular weight of 661.76 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(fluoren-9-ylidenemethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-dioxocyclopenta[a]naphthalene-7-carboxylic acid.
| Compound Name | (2E)-2-[[4-[4-(fluoren-9-ylidenemethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-dioxocyclopenta[a]naphthalene-7-carboxylic acid |
|---|---|
| PubChem CID | 135219308 |
| Molecular Formula | C46H31NO4 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | (2E)-2-[[4-[4-(fluoren-9-ylidenemethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-dioxocyclopenta[a]naphthalene-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c3c(ccc2c1)C(=O)/C(=C\c1ccc2c(c1)C1CCCC1N2c1ccc(C=C2c4ccccc4-c4ccccc42)cc1)C3=O |
| InChI | InChI=1S/C46H31NO4/c48-44-37-20-15-28-25-29(46(50)51)16-19-31(28)43(37)45(49)40(44)24-27-14-21-42-39(23-27)36-10-5-11-41(36)47(42)30-17-12-26(13-18-30)22-38-34-8-3-1-6-32(34)33-7-2-4-9-35(33)38/h1-4,6-9,12-25,36,41H,5,10-11H2,(H,50,51)/b40-24+ |
| InChIKey | FSJUTZGZJQTQLK-BKATUZMVSA-N |
| XLogP | 10.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|