C45H33NO4S2 — CID 126726766
(2E)-2-[[5-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid (PubChem CID 126726766) has the molecular formula C45H33NO4S2 and a molecular weight of 715.90 g/mol. Its IUPAC name is (2E)-2-[[5-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid.
| Compound Name | (2E)-2-[[5-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 126726766 |
| Molecular Formula | C45H33NO4S2 |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.19 |
| IUPAC Name | (2E)-2-[[5-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
| SMILES | CC1(C)c2ccccc2-c2cc(N3c4ccc(-c5ccc(-c6ccc(/C=C7\C(=O)c8ccc(C(=O)O)cc8C7=O)s6)s5)cc4C4CCCC43)ccc21 |
| InChI | InChI=1S/C45H33NO4S2/c1-45(2)35-8-4-3-6-28(35)31-22-26(12-15-36(31)45)46-37-9-5-7-29(37)32-20-24(11-16-38(32)46)39-18-19-41(52-39)40-17-13-27(51-40)23-34-42(47)30-14-10-25(44(49)50)21-33(30)43(34)48/h3-4,6,8,10-23,29,37H,5,7,9H2,1-2H3,(H,49,50)/b34-23+ |
| InChIKey | VIFSSTMGQLESSO-PPFNPFNJSA-N |
| XLogP | 11.40 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|