C43H33NO6S — CID 126726827
2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methylthiophen-2-yl]methylidene]-1,3-dioxoindene-5,6-dicarboxylic acid (PubChem CID 126726827) has the molecular formula C43H33NO6S and a molecular weight of 691.80 g/mol. Its IUPAC name is 2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methylthiophen-2-yl]methylidene]-1,3-dioxoindene-5,6-dicarboxylic acid.
| Compound Name | 2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methylthiophen-2-yl]methylidene]-1,3-dioxoindene-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 126726827 |
| Molecular Formula | C43H33NO6S |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | 2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methylthiophen-2-yl]methylidene]-1,3-dioxoindene-5,6-dicarboxylic acid |
| SMILES | Cc1cc(-c2ccc3c(c2)C2CCCC2N3c2ccc3c(c2)-c2ccccc2C3(C)C)sc1C=C1C(=O)c2cc(C(=O)O)c(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C43H33NO6S/c1-21-15-38(51-37(21)20-32-39(45)28-18-30(41(47)48)31(42(49)50)19-29(28)40(32)46)22-11-14-36-27(16-22)25-8-6-10-35(25)44(36)23-12-13-34-26(17-23)24-7-4-5-9-33(24)43(34,2)3/h4-5,7,9,11-20,25,35H,6,8,10H2,1-3H3,(H,47,48)(H,49,50) |
| InChIKey | KLNCFINDRWEYTH-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|