C35H27NO4S — CID 135215227
5-[[4-(9,9-dimethylfluoren-2-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4,6-dioxocyclopenta[b]thiophene-2-carboxylic acid (PubChem CID 135215227) has the molecular formula C35H27NO4S and a molecular weight of 557.67 g/mol. Its IUPAC name is 5-[[4-(9,9-dimethylfluoren-2-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4,6-dioxocyclopenta[b]thiophene-2-carboxylic acid.
| Compound Name | 5-[[4-(9,9-dimethylfluoren-2-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4,6-dioxocyclopenta[b]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 135215227 |
| Molecular Formula | C35H27NO4S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 5-[[4-(9,9-dimethylfluoren-2-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4,6-dioxocyclopenta[b]thiophene-2-carboxylic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N3c4ccc(C=C5C(=O)c6cc(C(=O)O)sc6C5=O)cc4C4CCCC43)cc21 |
| InChI | InChI=1S/C35H27NO4S/c1-35(2)26-8-4-3-6-20(26)21-12-11-19(16-27(21)35)36-28-9-5-7-22(28)23-14-18(10-13-29(23)36)15-24-31(37)25-17-30(34(39)40)41-33(25)32(24)38/h3-4,6,8,10-17,22,28H,5,7,9H2,1-2H3,(H,39,40) |
| InChIKey | KJZJOPBGVWIZLR-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|