C35H29N3O3 — CID 76574296
4-[[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid (PubChem CID 76574296) has the molecular formula C35H29N3O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is 4-[[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid.
| Compound Name | 4-[[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 76574296 |
| Molecular Formula | C35H29N3O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 4-[[1-(9,9-dimethylfluoren-2-yl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N3CCCc4cc(C=C5C(=O)N(c6ccccc6)N=C5C(=O)O)ccc43)cc21 |
| InChI | InChI=1S/C35H29N3O3/c1-35(2)29-13-7-6-12-26(29)27-16-15-25(21-30(27)35)37-18-8-9-23-19-22(14-17-31(23)37)20-28-32(34(40)41)36-38(33(28)39)24-10-4-3-5-11-24/h3-7,10-17,19-21H,8-9,18H2,1-2H3,(H,40,41) |
| InChIKey | IWPRDKCJRLXIPI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|