C24H28N4O3 — CID 89293384
(4Z)-5-(methylperoxyamino)-4-[[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 89293384) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4Z)-5-(methylperoxyamino)-4-[[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-5-(methylperoxyamino)-4-[[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 89293384 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (4Z)-5-(methylperoxyamino)-4-[[1-(2-methylpropyl)-3,4-dihydro-2H-quinolin-6-yl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | COONC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc2c(c1)CCCN2CC(C)C |
| InChI | InChI=1S/C24H28N4O3/c1-17(2)16-27-13-7-8-19-14-18(11-12-22(19)27)15-21-23(26-31-30-3)25-28(24(21)29)20-9-5-4-6-10-20/h4-6,9-12,14-15,17H,7-8,13,16H2,1-3H3,(H,25,26)/b21-15- |
| InChIKey | NZAGALYYKLSLSP-QNGOZBTKSA-N |
| XLogP | 3.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|