C30H37N3O4 — CID 158942785
(E)-3-(1-octyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-enal;5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid (PubChem CID 158942785) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is (E)-3-(1-octyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-enal;5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid.
| Compound Name | (E)-3-(1-octyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-enal;5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 158942785 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (E)-3-(1-octyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-enal;5-oxo-1-phenyl-4H-pyrazole-3-carboxylic acid |
| SMILES | CCCCCCCCN1CCCc2cc(/C=C/C=O)ccc21.O=C(O)C1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C20H29NO.C10H8N2O3/c1-2-3-4-5-6-7-14-21-15-8-11-19-17-18(10-9-16-22)12-13-20(19)21;13-9-6-8(10(14)15)11-12(9)7-4-2-1-3-5-7/h9-10,12-13,16-17H,2-8,11,14-15H2,1H3;1-5H,6H2,(H,14,15)/b10-9+; |
| InChIKey | JKLOAHJKWSEDTA-RRABGKBLSA-N |
| XLogP | 5.88 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|