C52H45N — CID 89071530
1-[7-[(E)-2-[2-ethenyl-3,3-diphenyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-9,9-dimethylfluoren-2-yl]-3,4-dihydro-2H-quinoline (PubChem CID 89071530) has the molecular formula C52H45N and a molecular weight of 683.94 g/mol. Its IUPAC name is 1-[7-[(E)-2-[2-ethenyl-3,3-diphenyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-9,9-dimethylfluoren-2-yl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[7-[(E)-2-[2-ethenyl-3,3-diphenyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-9,9-dimethylfluoren-2-yl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 89071530 |
| Molecular Formula | C52H45N |
| Molecular Weight | 683.94 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | 1-[7-[(E)-2-[2-ethenyl-3,3-diphenyl-1-[(Z)-prop-1-enyl]inden-5-yl]ethenyl]-9,9-dimethylfluoren-2-yl]-3,4-dihydro-2H-quinoline |
| SMILES | C=CC1=C(/C=C\C)c2ccc(/C=C/c3ccc4c(c3)C(C)(C)c3cc(N5CCCc6ccccc65)ccc3-4)cc2C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H45N/c1-5-16-42-45-30-27-37(34-49(45)52(46(42)6-2,39-19-9-7-10-20-39)40-21-11-8-12-22-40)25-24-36-26-29-43-44-31-28-41(35-48(44)51(3,4)47(43)33-36)53-32-15-18-38-17-13-14-23-50(38)53/h5-14,16-17,19-31,33-35H,2,15,18,32H2,1,3-4H3/b16-5-,25-24+ |
| InChIKey | LSTHMRYIXSLDHB-QBYKNNDYSA-N |
| XLogP | 13.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.94 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|