C49H46N2S — CID 90702964
10-[4-[2-[7-(3,4-dihydro-2H-quinolin-1-yl)-9,9-dimethylfluoren-2-yl]ethenyl]-2-ethenyl-3-prop-1-enylcyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine (PubChem CID 90702964) has the molecular formula C49H46N2S and a molecular weight of 694.99 g/mol. Its IUPAC name is 10-[4-[2-[7-(3,4-dihydro-2H-quinolin-1-yl)-9,9-dimethylfluoren-2-yl]ethenyl]-2-ethenyl-3-prop-1-enylcyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine.
| Compound Name | 10-[4-[2-[7-(3,4-dihydro-2H-quinolin-1-yl)-9,9-dimethylfluoren-2-yl]ethenyl]-2-ethenyl-3-prop-1-enylcyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine |
|---|---|
| PubChem CID | 90702964 |
| Molecular Formula | C49H46N2S |
| Molecular Weight | 694.99 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | 10-[4-[2-[7-(3,4-dihydro-2H-quinolin-1-yl)-9,9-dimethylfluoren-2-yl]ethenyl]-2-ethenyl-3-prop-1-enylcyclohexa-1,3-dien-1-yl]-4a,10a-dihydrophenothiazine |
| SMILES | C=CC1=C(N2c3ccccc3SC3C=CC=CC32)CCC(C=Cc2ccc3c(c2)C(C)(C)c2cc(N4CCCc5ccccc54)ccc2-3)=C1C=CC |
| InChI | InChI=1S/C49H46N2S/c1-5-14-38-34(25-29-44(37(38)6-2)51-45-18-9-11-20-47(45)52-48-21-12-10-19-46(48)51)24-22-33-23-27-39-40-28-26-36(32-42(40)49(3,4)41(39)31-33)50-30-13-16-35-15-7-8-17-43(35)50/h5-12,14-15,17-24,26-28,31-32,45,47H,2,13,16,25,29-30H2,1,3-4H3 |
| InChIKey | DIYDYVJADQAFIH-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.99 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |