C42H33N3O3 — CID 76790818
4-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid (PubChem CID 76790818) has the molecular formula C42H33N3O3 and a molecular weight of 627.74 g/mol. Its IUPAC name is 4-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid.
| Compound Name | 4-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 76790818 |
| Molecular Formula | C42H33N3O3 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | 4-[[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(c2ccccc2)C(=O)C1=Cc1ccc2c(c1)C1CCCC1N2c1ccc(C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H33N3O3/c46-41-37(40(42(47)48)43-45(41)33-15-8-3-9-16-33)27-29-21-24-39-36(26-29)34-17-10-18-38(34)44(39)32-22-19-28(20-23-32)25-35(30-11-4-1-5-12-30)31-13-6-2-7-14-31/h1-9,11-16,19-27,34,38H,10,17-18H2,(H,47,48) |
| InChIKey | VITXIVSXZDQUBO-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|