C24H22N2O3S2 — CID 58371315
3-[(5E)-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 58371315) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 3-[(5E)-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58371315 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[(5E)-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2ccc3c(c2)C2CCCC2N3c2ccccc2)SC1=S |
| InChI | InChI=1S/C24H22N2O3S2/c27-22(28)11-12-25-23(29)21(31-24(25)30)14-15-9-10-20-18(13-15)17-7-4-8-19(17)26(20)16-5-2-1-3-6-16/h1-3,5-6,9-10,13-14,17,19H,4,7-8,11-12H2,(H,27,28)/b21-14+ |
| InChIKey | VLAVBKVTGZULED-KGENOOAVSA-N |
| XLogP | 5.15 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|