C25H24N2O3S2 — CID 46847006
3-[(5E)-5-[(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 46847006) has the molecular formula C25H24N2O3S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-[(5E)-5-[(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 46847006 |
| Molecular Formula | C25H24N2O3S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 3-[(5E)-5-[(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2ccc3c(c2)C2CCCC2N3Cc2ccccc2)SC1=S |
| InChI | InChI=1S/C25H24N2O3S2/c28-23(29)11-12-26-24(30)22(32-25(26)31)14-17-9-10-21-19(13-17)18-7-4-8-20(18)27(21)15-16-5-2-1-3-6-16/h1-3,5-6,9-10,13-14,18,20H,4,7-8,11-12,15H2,(H,28,29)/b22-14+ |
| InChIKey | QKIPBAKJGMXCSS-HYARGMPZSA-N |
| XLogP | 5.02 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|