C40H36N2O3S2 — CID 147516036
3-[(5Z)-5-[[4-[7-[2,2-bis(4-methylphenyl)ethenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 147516036) has the molecular formula C40H36N2O3S2 and a molecular weight of 656.87 g/mol. Its IUPAC name is 3-[(5Z)-5-[[4-[7-[2,2-bis(4-methylphenyl)ethenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[4-[7-[2,2-bis(4-methylphenyl)ethenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 147516036 |
| Molecular Formula | C40H36N2O3S2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | 3-[(5Z)-5-[[4-[7-[2,2-bis(4-methylphenyl)ethenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1ccc(C(=Cc2ccc3c(c2)C2CCCC2N3c2ccc(/C=C3\SC(=S)N(CCC(=O)O)C3=O)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H36N2O3S2/c1-25-6-13-29(14-7-25)33(30-15-8-26(2)9-16-30)22-28-12-19-36-34(23-28)32-4-3-5-35(32)42(36)31-17-10-27(11-18-31)24-37-39(45)41(40(46)47-37)21-20-38(43)44/h6-19,22-24,32,35H,3-5,20-21H2,1-2H3,(H,43,44)/b37-24- |
| InChIKey | FKFZBOLKIOSPQQ-PNEAAFPUSA-N |
| XLogP | 9.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|