C38H27NO4S — CID 144980450
(2E)-2-[[4-[4-(9H-fluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2H-thiet-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid (PubChem CID 144980450) has the molecular formula C38H27NO4S and a molecular weight of 593.70 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(9H-fluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2H-thiet-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid.
| Compound Name | (2E)-2-[[4-[4-(9H-fluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2H-thiet-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 144980450 |
| Molecular Formula | C38H27NO4S |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | (2E)-2-[[4-[4-(9H-fluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-2H-thiet-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)/C(=C/C1C=C(c3ccc4c(c3)C3CCCC3N4c3ccc4c(c3)-c3ccccc3C4)S1)C2=O |
| InChI | InChI=1S/C38H27NO4S/c40-36-28-12-9-23(38(42)43)16-31(28)37(41)32(36)18-25-19-35(44-25)22-10-13-34-30(15-22)27-6-3-7-33(27)39(34)24-11-8-21-14-20-4-1-2-5-26(20)29(21)17-24/h1-2,4-5,8-13,15-19,25,27,33H,3,6-7,14H2,(H,42,43)/b32-18+ |
| InChIKey | QMVLJQIKMTYOCB-KCSSXMTESA-N |
| XLogP | 8.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|