C25H18N2O2 — CID 163479414
(E)-2-cyano-3-(5-phenyl-6,10b-dihydro-5aH-indeno[2,1-b]indol-2-yl)prop-2-enoic acid (PubChem CID 163479414) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-2-cyano-3-(5-phenyl-6,10b-dihydro-5aH-indeno[2,1-b]indol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-(5-phenyl-6,10b-dihydro-5aH-indeno[2,1-b]indol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 163479414 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (E)-2-cyano-3-(5-phenyl-6,10b-dihydro-5aH-indeno[2,1-b]indol-2-yl)prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc2c(c1)C1c3ccccc3CC1N2c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H18N2O2/c26-15-18(25(28)29)12-16-10-11-22-21(13-16)24-20-9-5-4-6-17(20)14-23(24)27(22)19-7-2-1-3-8-19/h1-13,23-24H,14H2,(H,28,29)/b18-12+ |
| InChIKey | CDFRNQGIHGVJPP-LDADJPATSA-N |
| XLogP | 4.89 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|