C13H11NO2 — CID 79885899
2-cyano-3-(2-cyclopropylphenyl)prop-2-enoic acid (PubChem CID 79885899) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-cyano-3-(2-cyclopropylphenyl)prop-2-enoic acid.
| Compound Name | 2-cyano-3-(2-cyclopropylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 79885899 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-cyano-3-(2-cyclopropylphenyl)prop-2-enoic acid |
| SMILES | N#CC(=Cc1ccccc1C1CC1)C(=O)O |
| InChI | InChI=1S/C13H11NO2/c14-8-11(13(15)16)7-10-3-1-2-4-12(10)9-5-6-9/h1-4,7,9H,5-6H2,(H,15,16) |
| InChIKey | SQMBPNYWRSJXLJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|