(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid

C10H5F2NO2 — CID 43312521

IUPAC(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid
SMILESN#C/C(=C\c1cc(F)ccc1F)C(=O)O
InChIInChI=1S/C10H5F2NO2/c11-8-1-2-9(12)6(4-8)3-7(5-13)10(14)15/h1-4H,(H,14,15)/b7-3+
InChIKeyMNHNYSAZXIBICQ-XVNBXDOJSA-N
MW209.15 g/mol
LogP1.96
Rot. Bonds2

About (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid

(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid (PubChem CID 43312521) has the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid
PubChem CID43312521
Molecular FormulaC10H5F2NO2
Molecular Weight209.15 g/mol
Exact Mass209.03
IUPAC Name(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid
SMILESN#C/C(=C\c1cc(F)ccc1F)C(=O)O
InChIInChI=1S/C10H5F2NO2/c11-8-1-2-9(12)6(4-8)3-7(5-13)10(14)15/h1-4H,(H,14,15)/b7-3+
InChIKeyMNHNYSAZXIBICQ-XVNBXDOJSA-N
XLogP1.96
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.15
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid?
The IUPAC name of (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid (CID 43312521) is (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid.
What is the SMILES notation for (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid?
The canonical SMILES for (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid is N#C/C(=C\c1cc(F)ccc1F)C(=O)O.
What is the InChIKey of (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid?
The InChIKey is MNHNYSAZXIBICQ-XVNBXDOJSA-N. The full InChI is InChI=1S/C10H5F2NO2/c11-8-1-2-9(12)6(4-8)3-7(5-13)10(14)15/h1-4H,(H,14,15)/b7-3+.
What are the key properties of (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid?
(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid has a molecular weight of 209.15 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enoic acid is sourced from PubChem (CID 43312521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).