C10H6F2N2O — CID 122366406
(E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enamide (PubChem CID 122366406) has the molecular formula C10H6F2N2O and a molecular weight of 208.17 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122366406 |
| Molecular Formula | C10H6F2N2O |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (E)-2-cyano-3-(2,5-difluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(F)ccc1F)C(N)=O |
| InChI | InChI=1S/C10H6F2N2O/c11-8-1-2-9(12)6(4-8)3-7(5-13)10(14)15/h1-4H,(H2,14,15)/b7-3+ |
| InChIKey | MFXJKMGNNRAHAL-XVNBXDOJSA-N |
| XLogP | 1.36 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|