C10H4Cl3NO2 — CID 67417367
(E)-2-cyano-3-(2,3,5-trichlorophenyl)prop-2-enoic acid (PubChem CID 67417367) has the molecular formula C10H4Cl3NO2 and a molecular weight of 276.51 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,3,5-trichlorophenyl)prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-(2,3,5-trichlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67417367 |
| Molecular Formula | C10H4Cl3NO2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 274.93 |
| IUPAC Name | (E)-2-cyano-3-(2,3,5-trichlorophenyl)prop-2-enoic acid |
| SMILES | N#C/C(=C\c1cc(Cl)cc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C10H4Cl3NO2/c11-7-2-5(9(13)8(12)3-7)1-6(4-14)10(15)16/h1-3H,(H,15,16)/b6-1+ |
| InChIKey | HPCIQULPNPNOTC-LZCJLJQNSA-N |
| XLogP | 3.64 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|