C38H27N3O4S2 — CID 91459206
2-cyano-3-[5-[5-[9-(9-ethylcarbazol-2-yl)-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 91459206) has the molecular formula C38H27N3O4S2 and a molecular weight of 653.79 g/mol. Its IUPAC name is 2-cyano-3-[5-[5-[9-(9-ethylcarbazol-2-yl)-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[5-[5-[9-(9-ethylcarbazol-2-yl)-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91459206 |
| Molecular Formula | C38H27N3O4S2 |
| Molecular Weight | 653.79 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | 2-cyano-3-[5-[5-[9-(9-ethylcarbazol-2-yl)-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCn1c2ccccc2c2ccc(N3CCCc4cc5cc(-c6ccc(-c7ccc(C=C(C#N)C(=O)O)s7)s6)c(=O)oc5cc43)cc21 |
| InChI | InChI=1S/C38H27N3O4S2/c1-2-40-30-8-4-3-7-27(30)28-11-9-25(19-32(28)40)41-15-5-6-22-16-23-18-29(38(44)45-33(23)20-31(22)41)34-13-14-36(47-34)35-12-10-26(46-35)17-24(21-39)37(42)43/h3-4,7-14,16-20H,2,5-6,15H2,1H3,(H,42,43) |
| InChIKey | SHOZQUXDDSDVQS-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.79 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|