C30H15F5N2O4S2 — CID 91361487
2-cyano-3-[5-[5-[2-oxo-9-(2,3,4,5,6-pentafluorophenyl)-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 91361487) has the molecular formula C30H15F5N2O4S2 and a molecular weight of 626.58 g/mol. Its IUPAC name is 2-cyano-3-[5-[5-[2-oxo-9-(2,3,4,5,6-pentafluorophenyl)-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[5-[5-[2-oxo-9-(2,3,4,5,6-pentafluorophenyl)-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91361487 |
| Molecular Formula | C30H15F5N2O4S2 |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 2-cyano-3-[5-[5-[2-oxo-9-(2,3,4,5,6-pentafluorophenyl)-7,8-dihydro-6H-pyrano[3,2-g]quinolin-3-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#CC(=Cc1ccc(-c2ccc(-c3cc4cc5c(cc4oc3=O)N(c3c(F)c(F)c(F)c(F)c3F)CCC5)s2)s1)C(=O)O |
| InChI | InChI=1S/C30H15F5N2O4S2/c31-23-24(32)26(34)28(27(35)25(23)33)37-7-1-2-13-8-14-10-17(30(40)41-19(14)11-18(13)37)20-5-6-22(43-20)21-4-3-16(42-21)9-15(12-36)29(38)39/h3-6,8-11H,1-2,7H2,(H,38,39) |
| InChIKey | KPYIXMNCKCEWIC-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|