C43H23N3O3S3 — CID 132508434
(E)-2-cyano-3-[5-[5-[5-(9-oxofluoren-2-yl)thiophen-2-yl]-2,3-diphenylthieno[3,4-b]pyrazin-7-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 132508434) has the molecular formula C43H23N3O3S3 and a molecular weight of 725.88 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-[5-(9-oxofluoren-2-yl)thiophen-2-yl]-2,3-diphenylthieno[3,4-b]pyrazin-7-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-[5-(9-oxofluoren-2-yl)thiophen-2-yl]-2,3-diphenylthieno[3,4-b]pyrazin-7-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 132508434 |
| Molecular Formula | C43H23N3O3S3 |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 725.09 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-[5-(9-oxofluoren-2-yl)thiophen-2-yl]-2,3-diphenylthieno[3,4-b]pyrazin-7-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2sc(-c3ccc(-c4ccc5c(c4)C(=O)c4ccccc4-5)s3)c3nc(-c4ccccc4)c(-c4ccccc4)nc23)s1)C(=O)O |
| InChI | InChI=1S/C43H23N3O3S3/c44-23-27(43(48)49)21-28-16-18-34(50-28)41-38-39(46-37(25-11-5-2-6-12-25)36(45-38)24-9-3-1-4-10-24)42(52-41)35-20-19-33(51-35)26-15-17-30-29-13-7-8-14-31(29)40(47)32(30)22-26/h1-22H,(H,48,49)/b27-21+ |
| InChIKey | XXPYWCBNSFDMPW-SZXQPVLSSA-N |
| XLogP | 11.35 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|