C26H10N4O4S5 — CID 170899973
(Z)-3-[5-[14-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4,10,13-trithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 170899973) has the molecular formula C26H10N4O4S5 and a molecular weight of 602.73 g/mol. Its IUPAC name is (Z)-3-[5-[14-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4,10,13-trithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[14-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4,10,13-trithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 170899973 |
| Molecular Formula | C26H10N4O4S5 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 601.93 |
| IUPAC Name | (Z)-3-[5-[14-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4,10,13-trithia-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C/c1ccc(-c2cc3c4nsnc4c4cc(-c5ccc(/C=C(/C#N)C(=O)O)s5)sc4c3s2)s1)C(=O)O |
| InChI | InChI=1S/C26H10N4O4S5/c27-9-11(25(31)32)5-13-1-3-17(35-13)19-7-15-21-22(30-39-29-21)16-8-20(38-24(16)23(15)37-19)18-4-2-14(36-18)6-12(10-28)26(33)34/h1-8H,(H,31,32)(H,33,34)/b11-5-,12-6- |
| InChIKey | SAWJTDRRGSXORN-CBIKUMSCSA-N |
| XLogP | 7.56 |
| TPSA | 147.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|