C40H26N2O2S2 — CID 71044216
(E)-2-cyano-3-[5-[(E)-2-[5-[9-[(9R)-9-methyl-9H-fluoren-2-yl]carbazol-3-yl]thiophen-2-yl]ethenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 71044216) has the molecular formula C40H26N2O2S2 and a molecular weight of 630.79 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[(E)-2-[5-[9-[(9R)-9-methyl-9H-fluoren-2-yl]carbazol-3-yl]thiophen-2-yl]ethenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[(E)-2-[5-[9-[(9R)-9-methyl-9H-fluoren-2-yl]carbazol-3-yl]thiophen-2-yl]ethenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71044216 |
| Molecular Formula | C40H26N2O2S2 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | (E)-2-cyano-3-[5-[(E)-2-[5-[9-[(9R)-9-methyl-9H-fluoren-2-yl]carbazol-3-yl]thiophen-2-yl]ethenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | C[C@@H]1c2ccccc2-c2ccc(-n3c4ccccc4c4cc(-c5ccc(/C=C/c6ccc(/C=C(\C#N)C(=O)O)s6)s5)ccc43)cc21 |
| InChI | InChI=1S/C40H26N2O2S2/c1-24-31-6-2-3-7-32(31)33-17-11-27(22-35(24)33)42-37-9-5-4-8-34(37)36-21-25(10-18-38(36)42)39-19-16-29(46-39)13-12-28-14-15-30(45-28)20-26(23-41)40(43)44/h2-22,24H,1H3,(H,43,44)/b13-12+,26-20+/t24-/m1/s1 |
| InChIKey | UJIPFDCZKJNOTB-OJEDLWLJSA-N |
| XLogP | 10.87 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|