C40H34N2O6S2 — CID 161295349
5-[(E)-8-cyano-9-[5-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-7-oxonon-8-enoxy]benzene-1,3-dicarboxylic acid (PubChem CID 161295349) has the molecular formula C40H34N2O6S2 and a molecular weight of 702.85 g/mol. Its IUPAC name is 5-[(E)-8-cyano-9-[5-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-7-oxonon-8-enoxy]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(E)-8-cyano-9-[5-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-7-oxonon-8-enoxy]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 161295349 |
| Molecular Formula | C40H34N2O6S2 |
| Molecular Weight | 702.85 g/mol |
| Exact Mass | 702.19 |
| IUPAC Name | 5-[(E)-8-cyano-9-[5-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-7-oxonon-8-enoxy]benzene-1,3-dicarboxylic acid |
| SMILES | CCn1c2ccccc2c2cc(-c3ccc(-c4ccc(/C=C(\C#N)C(=O)CCCCCCOc5cc(C(=O)O)cc(C(=O)O)c5)s4)s3)ccc21 |
| InChI | InChI=1S/C40H34N2O6S2/c1-2-42-33-10-7-6-9-31(33)32-23-25(12-14-34(32)42)36-16-17-38(50-36)37-15-13-30(49-37)22-28(24-41)35(43)11-5-3-4-8-18-48-29-20-26(39(44)45)19-27(21-29)40(46)47/h6-7,9-10,12-17,19-23H,2-5,8,11,18H2,1H3,(H,44,45)(H,46,47)/b28-22+ |
| InChIKey | BFGYKCODVFWXJB-XAYXJRQQSA-N |
| XLogP | 10.17 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.85 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|