C49H38N2O3S — CID 158694625
(E)-9-cyano-10-[5-[10-(dinaphthalen-2-ylamino)anthracen-9-yl]thiophen-2-yl]-8-oxodec-9-enoic acid (PubChem CID 158694625) has the molecular formula C49H38N2O3S and a molecular weight of 734.92 g/mol. Its IUPAC name is (E)-9-cyano-10-[5-[10-(dinaphthalen-2-ylamino)anthracen-9-yl]thiophen-2-yl]-8-oxodec-9-enoic acid.
| Compound Name | (E)-9-cyano-10-[5-[10-(dinaphthalen-2-ylamino)anthracen-9-yl]thiophen-2-yl]-8-oxodec-9-enoic acid |
|---|---|
| PubChem CID | 158694625 |
| Molecular Formula | C49H38N2O3S |
| Molecular Weight | 734.92 g/mol |
| Exact Mass | 734.26 |
| IUPAC Name | (E)-9-cyano-10-[5-[10-(dinaphthalen-2-ylamino)anthracen-9-yl]thiophen-2-yl]-8-oxodec-9-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2c3ccccc3c(N(c3ccc4ccccc4c3)c3ccc4ccccc4c3)c3ccccc23)s1)C(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C49H38N2O3S/c50-32-37(45(52)21-3-1-2-4-22-47(53)54)31-40-27-28-46(55-40)48-41-17-9-11-19-43(41)49(44-20-12-10-18-42(44)48)51(38-25-23-33-13-5-7-15-35(33)29-38)39-26-24-34-14-6-8-16-36(34)30-39/h5-20,23-31H,1-4,21-22H2,(H,53,54)/b37-31+ |
| InChIKey | KQFJIWDWSYMZID-USLOJTSYSA-N |
| XLogP | 13.40 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.92 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|