C52H53N7O2 — CID 58660273
(2Z,4E)-7,7-bis[4-[4-(dimethylamino)-N-[4-(dimethylamino)phenyl]anilino]phenyl]-2-isocyanohepta-2,4,6-trienoic acid (PubChem CID 58660273) has the molecular formula C52H53N7O2 and a molecular weight of 808.04 g/mol. Its IUPAC name is (2Z,4E)-7,7-bis[4-[4-(dimethylamino)-N-[4-(dimethylamino)phenyl]anilino]phenyl]-2-isocyanohepta-2,4,6-trienoic acid.
| Compound Name | (2Z,4E)-7,7-bis[4-[4-(dimethylamino)-N-[4-(dimethylamino)phenyl]anilino]phenyl]-2-isocyanohepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 58660273 |
| Molecular Formula | C52H53N7O2 |
| Molecular Weight | 808.04 g/mol |
| Exact Mass | 807.43 |
| IUPAC Name | (2Z,4E)-7,7-bis[4-[4-(dimethylamino)-N-[4-(dimethylamino)phenyl]anilino]phenyl]-2-isocyanohepta-2,4,6-trienoic acid |
| SMILES | [C-]#[N+]/C(=C\C=C\C=C(c1ccc(N(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1)c1ccc(N(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C52H53N7O2/c1-53-51(52(60)61)13-11-10-12-50(38-14-18-44(19-15-38)58(46-30-22-40(23-31-46)54(2)3)47-32-24-41(25-33-47)55(4)5)39-16-20-45(21-17-39)59(48-34-26-42(27-35-48)56(6)7)49-36-28-43(29-37-49)57(8)9/h10-37H,2-9H3,(H,60,61)/b11-10+,51-13- |
| InChIKey | DNXCVDAUDNJSFA-JDVSQBNYSA-N |
| XLogP | 11.77 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.04 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|