C41H38N2O8S2 — CID 123163061
3-[5-[7-[4-(N-(4-butoxyphenyl)-4-propoxyanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid (PubChem CID 123163061) has the molecular formula C41H38N2O8S2 and a molecular weight of 750.89 g/mol. Its IUPAC name is 3-[5-[7-[4-(N-(4-butoxyphenyl)-4-propoxyanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[5-[7-[4-(N-(4-butoxyphenyl)-4-propoxyanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 123163061 |
| Molecular Formula | C41H38N2O8S2 |
| Molecular Weight | 750.89 g/mol |
| Exact Mass | 750.21 |
| IUPAC Name | 3-[5-[7-[4-(N-(4-butoxyphenyl)-4-propoxyanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCOc1ccc(N(c2ccc(OCCC)cc2)c2ccc(-c3sc(-c4sc(C=C(C#N)C(=O)O)c5c4OCCO5)c4c3OCCO4)cc2)cc1 |
| InChI | InChI=1S/C41H38N2O8S2/c1-3-5-19-47-32-16-12-30(13-17-32)43(29-10-14-31(15-11-29)46-18-4-2)28-8-6-26(7-9-28)38-36-37(51-23-22-50-36)40(53-38)39-35-34(48-20-21-49-35)33(52-39)24-27(25-42)41(44)45/h6-17,24H,3-5,18-23H2,1-2H3,(H,44,45) |
| InChIKey | XUUGZCCCPSUELC-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.89 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|