C34H28N4O5S2 — CID 118530806
(E)-2-cyano-3-[5-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 118530806) has the molecular formula C34H28N4O5S2 and a molecular weight of 636.76 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118530806 |
| Molecular Formula | C34H28N4O5S2 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | (E)-2-cyano-3-[5-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | COc1cc(C2CC(c3ccc(/C=C(\C#N)C(=O)O)s3)=NN2c2ccc(-c3nc4ccc(C)cc4s3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C34H28N4O5S2/c1-19-5-11-25-31(13-19)45-33(36-25)20-6-8-23(9-7-20)38-27(21-15-28(41-2)32(43-4)29(16-21)42-3)17-26(37-38)30-12-10-24(44-30)14-22(18-35)34(39)40/h5-16,27H,17H2,1-4H3,(H,39,40)/b22-14+ |
| InChIKey | RLXULHCGPQQOKK-HYARGMPZSA-N |
| XLogP | 7.71 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|