C32H25Br2N3S3 — CID 102575700
(E)-2-(5-bromothiophen-2-yl)-3-[7-[(E)-2-(5-bromothiophen-2-yl)-2-cyanoethenyl]-10-hexylphenothiazin-3-yl]prop-2-enenitrile (PubChem CID 102575700) has the molecular formula C32H25Br2N3S3 and a molecular weight of 707.58 g/mol. Its IUPAC name is (E)-2-(5-bromothiophen-2-yl)-3-[7-[(E)-2-(5-bromothiophen-2-yl)-2-cyanoethenyl]-10-hexylphenothiazin-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(5-bromothiophen-2-yl)-3-[7-[(E)-2-(5-bromothiophen-2-yl)-2-cyanoethenyl]-10-hexylphenothiazin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 102575700 |
| Molecular Formula | C32H25Br2N3S3 |
| Molecular Weight | 707.58 g/mol |
| Exact Mass | 704.96 |
| IUPAC Name | (E)-2-(5-bromothiophen-2-yl)-3-[7-[(E)-2-(5-bromothiophen-2-yl)-2-cyanoethenyl]-10-hexylphenothiazin-3-yl]prop-2-enenitrile |
| SMILES | CCCCCCN1c2ccc(/C=C(\C#N)c3ccc(Br)s3)cc2Sc2cc(/C=C(\C#N)c3ccc(Br)s3)ccc21 |
| InChI | InChI=1S/C32H25Br2N3S3/c1-2-3-4-5-14-37-25-8-6-21(15-23(19-35)27-10-12-31(33)39-27)17-29(25)38-30-18-22(7-9-26(30)37)16-24(20-36)28-11-13-32(34)40-28/h6-13,15-18H,2-5,14H2,1H3/b23-15+,24-16+ |
| InChIKey | TVZOHKKESCQUOD-DFEHQXHXSA-N |
| XLogP | 11.65 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.58 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|