C53H66N2O4S3 — CID 177471061
(Z)-2-cyano-3-[10-[5-(4-hexoxy-N-(4-hexoxyphenyl)anilino)thiophen-2-yl]-7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid (PubChem CID 177471061) has the molecular formula C53H66N2O4S3 and a molecular weight of 891.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-[10-[5-(4-hexoxy-N-(4-hexoxyphenyl)anilino)thiophen-2-yl]-7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[10-[5-(4-hexoxy-N-(4-hexoxyphenyl)anilino)thiophen-2-yl]-7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177471061 |
| Molecular Formula | C53H66N2O4S3 |
| Molecular Weight | 891.32 g/mol |
| Exact Mass | 890.42 |
| IUPAC Name | (Z)-2-cyano-3-[10-[5-(4-hexoxy-N-(4-hexoxyphenyl)anilino)thiophen-2-yl]-7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3cc4c(s3)-c3sc(/C=C(/C#N)C(=O)O)cc3C4(CCCCCC)CCCCCC)s2)cc1 |
| InChI | InChI=1S/C53H66N2O4S3/c1-5-9-13-17-31-53(32-18-14-10-6-2)45-36-44(35-39(38-54)52(56)57)60-50(45)51-46(53)37-48(62-51)47-29-30-49(61-47)55(40-21-25-42(26-22-40)58-33-19-15-11-7-3)41-23-27-43(28-24-41)59-34-20-16-12-8-4/h21-30,35-37H,5-20,31-34H2,1-4H3,(H,56,57)/b39-35- |
| InChIKey | SSQSNKCPOHASKN-ICKFRXAFSA-N |
| XLogP | 17.12 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.32 |
| LogP ≤ 5 | 17.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|