C27H47NO4 — CID 130327979
bis(2-ethylhexyl) 2-[(E)-3-piperidin-1-ylprop-2-enylidene]propanedioate (PubChem CID 130327979) has the molecular formula C27H47NO4 and a molecular weight of 449.68 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-[(E)-3-piperidin-1-ylprop-2-enylidene]propanedioate.
| Compound Name | bis(2-ethylhexyl) 2-[(E)-3-piperidin-1-ylprop-2-enylidene]propanedioate |
|---|---|
| PubChem CID | 130327979 |
| Molecular Formula | C27H47NO4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | bis(2-ethylhexyl) 2-[(E)-3-piperidin-1-ylprop-2-enylidene]propanedioate |
| SMILES | CCCCC(CC)COC(=O)C(=C/C=C/N1CCCCC1)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C27H47NO4/c1-5-9-15-23(7-3)21-31-26(29)25(17-14-20-28-18-12-11-13-19-28)27(30)32-22-24(8-4)16-10-6-2/h14,17,20,23-24H,5-13,15-16,18-19,21-22H2,1-4H3/b20-14+,25-17? |
| InChIKey | PNWOVCBYINZTSF-QHJBQMLTSA-N |
| XLogP | 6.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|