C33H54N4O4 — CID 146188162
2-ethylhexyl (2E,4E)-5-[4-[(1E,3E)-4-amino-5-(2-ethylhexoxy)-3-methyl-5-oxopenta-1,3-dienyl]piperazin-1-yl]-2-cyano-3-methylpenta-2,4-dienoate (PubChem CID 146188162) has the molecular formula C33H54N4O4 and a molecular weight of 570.82 g/mol. Its IUPAC name is 2-ethylhexyl (2E,4E)-5-[4-[(1E,3E)-4-amino-5-(2-ethylhexoxy)-3-methyl-5-oxopenta-1,3-dienyl]piperazin-1-yl]-2-cyano-3-methylpenta-2,4-dienoate.
| Compound Name | 2-ethylhexyl (2E,4E)-5-[4-[(1E,3E)-4-amino-5-(2-ethylhexoxy)-3-methyl-5-oxopenta-1,3-dienyl]piperazin-1-yl]-2-cyano-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 146188162 |
| Molecular Formula | C33H54N4O4 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | 2-ethylhexyl (2E,4E)-5-[4-[(1E,3E)-4-amino-5-(2-ethylhexoxy)-3-methyl-5-oxopenta-1,3-dienyl]piperazin-1-yl]-2-cyano-3-methylpenta-2,4-dienoate |
| SMILES | CCCCC(CC)COC(=O)/C(N)=C(C)\C=C\N1CCN(/C=C/C(C)=C(\C#N)C(=O)OCC(CC)CCCC)CC1 |
| InChI | InChI=1S/C33H54N4O4/c1-7-11-13-28(9-3)24-40-32(38)30(23-34)26(5)15-17-36-19-21-37(22-20-36)18-16-27(6)31(35)33(39)41-25-29(10-4)14-12-8-2/h15-18,28-29H,7-14,19-22,24-25,35H2,1-6H3/b17-15+,18-16+,30-26+,31-27+ |
| InChIKey | PZRUCGRHAQMTEP-QWRXGHTPSA-N |
| XLogP | 6.22 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|