About bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate
bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate (PubChem CID 130327971) has the molecular formula C26H45NO4
and a molecular weight of 435.65 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate |
| PubChem CID | 130327971 |
| Molecular Formula | C26H45NO4 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.33 |
| IUPAC Name | bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate |
| SMILES | CCCCC(CC)COC(=O)C(=C/C=C1\CCCN1C)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C26H45NO4/c1-6-10-13-21(8-3)19-30-25(28)24(17-16-23-15-12-18-27(23)5)26(29)31-20-22(9-4)14-11-7-2/h16-17,21-22H,6-15,18-20H2,1-5H3/b23-16+,24-17? |
| InChIKey | PXOXNQYUWZKMSQ-PSERORDQSA-N |
| XLogP | 6.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate?
The IUPAC name of bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate (CID 130327971) is bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate.
What is the SMILES notation for bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate?
The canonical SMILES for bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate is CCCCC(CC)COC(=O)C(=C/C=C1\CCCN1C)C(=O)OCC(CC)CCCC.
What is the InChIKey of bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate?
The InChIKey is PXOXNQYUWZKMSQ-PSERORDQSA-N. The full InChI is InChI=1S/C26H45NO4/c1-6-10-13-21(8-3)19-30-25(28)24(17-16-23-15-12-18-27(23)5)26(29)31-20-22(9-4)14-11-7-2/h16-17,21-22H,6-15,18-20H2,1-5H3/b23-16+,24-17?.
What are the key properties of bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate?
bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate has a molecular weight of 435.65 g/mol, XLogP of 6.04, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) 2-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]propanedioate is sourced from PubChem (CID 130327971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).