C19H32O4 — CID 141004678
2-ethylhexyl (2Z)-3,3-dimethyl-2-(2-methylprop-2-enoyloxymethylidene)butanoate (PubChem CID 141004678) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-ethylhexyl (2Z)-3,3-dimethyl-2-(2-methylprop-2-enoyloxymethylidene)butanoate.
| Compound Name | 2-ethylhexyl (2Z)-3,3-dimethyl-2-(2-methylprop-2-enoyloxymethylidene)butanoate |
|---|---|
| PubChem CID | 141004678 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-ethylhexyl (2Z)-3,3-dimethyl-2-(2-methylprop-2-enoyloxymethylidene)butanoate |
| SMILES | C=C(C)C(=O)O/C=C(\C(=O)OCC(CC)CCCC)C(C)(C)C |
| InChI | InChI=1S/C19H32O4/c1-8-10-11-15(9-2)12-22-18(21)16(19(5,6)7)13-23-17(20)14(3)4/h13,15H,3,8-12H2,1-2,4-7H3/b16-13+ |
| InChIKey | ZKAVWLSVWDHCCS-DTQAZKPQSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|